C17H33N3O10 — CID 177154512
(2R,3R,4R,5R)-N-[2-(2-aminoethylamino)ethyl]-4-[(2R,3R,5R,6S)-3,5-dihydroxy-6-(1-hydroxyethenyl)oxan-2-yl]oxy-2,3,5,6-tetrahydroxyhexanamide (PubChem CID 177154512) has the molecular formula C17H33N3O10 and a molecular weight of 439.46 g/mol. Its IUPAC name is (2R,3R,4R,5R)-N-[2-(2-aminoethylamino)ethyl]-4-[(2R,3R,5R,6S)-3,5-dihydroxy-6-(1-hydroxyethenyl)oxan-2-yl]oxy-2,3,5,6-tetrahydroxyhexanamide.
| Compound Name | (2R,3R,4R,5R)-N-[2-(2-aminoethylamino)ethyl]-4-[(2R,3R,5R,6S)-3,5-dihydroxy-6-(1-hydroxyethenyl)oxan-2-yl]oxy-2,3,5,6-tetrahydroxyhexanamide |
|---|---|
| PubChem CID | 177154512 |
| Molecular Formula | C17H33N3O10 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | (2R,3R,4R,5R)-N-[2-(2-aminoethylamino)ethyl]-4-[(2R,3R,5R,6S)-3,5-dihydroxy-6-(1-hydroxyethenyl)oxan-2-yl]oxy-2,3,5,6-tetrahydroxyhexanamide |
| SMILES | C=C(O)[C@H]1O[C@@H](O[C@@H]([C@H](O)[C@@H](O)C(=O)NCCNCCN)[C@H](O)CO)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C17H33N3O10/c1-8(22)14-9(23)6-10(24)17(29-14)30-15(11(25)7-21)12(26)13(27)16(28)20-5-4-19-3-2-18/h9-15,17,19,21-27H,1-7,18H2,(H,20,28)/t9-,10-,11-,12-,13-,14-,15-,17+/m1/s1 |
| InChIKey | NEBRVQGOUIZQIL-QNYDAKCSSA-N |
| XLogP | -4.98 |
| TPSA | 227.22 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | -4.98 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|