C26H20N4O — CID 177154610
(1R,11R)-5-[4-(aminomethyl)phenyl]-18-ethynyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one (PubChem CID 177154610) has the molecular formula C26H20N4O and a molecular weight of 404.47 g/mol. Its IUPAC name is (1R,11R)-5-[4-(aminomethyl)phenyl]-18-ethynyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one.
| Compound Name | (1R,11R)-5-[4-(aminomethyl)phenyl]-18-ethynyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one |
|---|---|
| PubChem CID | 177154610 |
| Molecular Formula | C26H20N4O |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (1R,11R)-5-[4-(aminomethyl)phenyl]-18-ethynyl-2,9,12-triazapentacyclo[9.8.1.02,10.03,8.014,19]icosa-3(8),4,6,9,14,16,18-heptaen-13-one |
| SMILES | C#Cc1cccc2c1[C@H]1C[C@@H](NC2=O)c2nc3ccc(-c4ccc(CN)cc4)cc3n21 |
| InChI | InChI=1S/C26H20N4O/c1-2-16-4-3-5-19-24(16)23-13-21(29-26(19)31)25-28-20-11-10-18(12-22(20)30(23)25)17-8-6-15(14-27)7-9-17/h1,3-12,21,23H,13-14,27H2,(H,29,31)/t21-,23-/m1/s1 |
| InChIKey | LEELKHZOLKXDKF-FYYLOGMGSA-N |
| XLogP | 3.92 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|