C29H30N6O — CID 177154676
10-ethyl-16-[(Z)-3-imino-1-(pyrrolidin-2-ylmethylideneamino)prop-1-en-2-yl]-9-methyl-3-prop-1-ynyl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,11,13(18),14,16-heptaen-8-one (PubChem CID 177154676) has the molecular formula C29H30N6O and a molecular weight of 478.60 g/mol. Its IUPAC name is 10-ethyl-16-[(Z)-3-imino-1-(pyrrolidin-2-ylmethylideneamino)prop-1-en-2-yl]-9-methyl-3-prop-1-ynyl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,11,13(18),14,16-heptaen-8-one.
| Compound Name | 10-ethyl-16-[(Z)-3-imino-1-(pyrrolidin-2-ylmethylideneamino)prop-1-en-2-yl]-9-methyl-3-prop-1-ynyl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,11,13(18),14,16-heptaen-8-one |
|---|---|
| PubChem CID | 177154676 |
| Molecular Formula | C29H30N6O |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 10-ethyl-16-[(Z)-3-imino-1-(pyrrolidin-2-ylmethylideneamino)prop-1-en-2-yl]-9-methyl-3-prop-1-ynyl-1,9,12-triazatetracyclo[9.7.0.02,7.013,18]octadeca-2,4,6,11,13(18),14,16-heptaen-8-one |
| SMILES | [H]/N=C/C(=C\N=C\C1CCCN1)c1ccc2nc3n(c2c1)-c1c(C#CC)cccc1C(=O)N(C)C3CC |
| InChI | InChI=1S/C29H30N6O/c1-4-8-19-9-6-11-23-27(19)35-26-15-20(21(16-30)17-31-18-22-10-7-14-32-22)12-13-24(26)33-28(35)25(5-2)34(3)29(23)36/h6,9,11-13,15-18,22,25,30,32H,5,7,10,14H2,1-3H3/b21-17+,30-16+,31-18+ |
| InChIKey | XHXOPXDUUQISRF-GWNGRKQISA-N |
| XLogP | 4.75 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|