C19H28N2O — CID 177155554
2-(cyclopropylmethyl)-4-methyl-5-piperidin-3-ylbenzamide;ethene (PubChem CID 177155554) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-4-methyl-5-piperidin-3-ylbenzamide;ethene.
| Compound Name | 2-(cyclopropylmethyl)-4-methyl-5-piperidin-3-ylbenzamide;ethene |
|---|---|
| PubChem CID | 177155554 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 2-(cyclopropylmethyl)-4-methyl-5-piperidin-3-ylbenzamide;ethene |
| SMILES | C=C.Cc1cc(CC2CC2)c(C(N)=O)cc1C1CCCNC1 |
| InChI | InChI=1S/C17H24N2O.C2H4/c1-11-7-14(8-12-4-5-12)16(17(18)20)9-15(11)13-3-2-6-19-10-13;1-2/h7,9,12-13,19H,2-6,8,10H2,1H3,(H2,18,20);1-2H2 |
| InChIKey | CKUNIVFUPQQTMM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|