About CID 177155929
CID 177155929 (PubChem CID 177155929) has the molecular formula C11H16IO
and a molecular weight of 291.15 g/mol.
Molecular Properties
| Compound Name | CID 177155929 |
| PubChem CID | 177155929 |
| Molecular Formula | C11H16IO |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | — |
| SMILES | CCCC[I]Oc1ccc(C)cc1 |
| InChI | InChI=1S/C11H16IO/c1-3-4-9-12-13-11-7-5-10(2)6-8-11/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | IIMIZCAWJWZVIJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 177155929 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177155929?
The IUPAC name of CID 177155929 (CID 177155929) is not available.
What is the SMILES notation for CID 177155929?
The canonical SMILES for CID 177155929 is CCCC[I]Oc1ccc(C)cc1.
What is the InChIKey of CID 177155929?
The InChIKey is IIMIZCAWJWZVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16IO/c1-3-4-9-12-13-11-7-5-10(2)6-8-11/h5-8H,3-4,9H2,1-2H3.
What are the key properties of CID 177155929?
CID 177155929 has a molecular weight of 291.15 g/mol, XLogP of 4.06, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177155929 is sourced from PubChem (CID 177155929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).