About acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate
acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate (PubChem CID 177156119) has the molecular formula C18H32N2O8
and a molecular weight of 404.46 g/mol. Its IUPAC name is acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate.
Molecular Properties
| Compound Name | acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate |
| PubChem CID | 177156119 |
| Molecular Formula | C18H32N2O8 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate |
| SMILES | C/C=N\N(C)/C(=C\C)C1CCC(COC(=O)OCC)O1.CC(=O)O.CC(=O)O |
| InChI | InChI=1S/C14H24N2O4.2C2H4O2/c1-5-12(16(4)15-6-2)13-9-8-11(20-13)10-19-14(17)18-7-3;2*1-2(3)4/h5-6,11,13H,7-10H2,1-4H3;2*1H3,(H,3,4)/b12-5-,15-6-;; |
| InChIKey | LPNYNJDUHIUDPN-MTLSYJNUSA-N |
| XLogP | 2.73 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate?
The IUPAC name of acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate (CID 177156119) is acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate.
What is the SMILES notation for acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate?
The canonical SMILES for acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate is C/C=N\N(C)/C(=C\C)C1CCC(COC(=O)OCC)O1.CC(=O)O.CC(=O)O.
What is the InChIKey of acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate?
The InChIKey is LPNYNJDUHIUDPN-MTLSYJNUSA-N. The full InChI is InChI=1S/C14H24N2O4.2C2H4O2/c1-5-12(16(4)15-6-2)13-9-8-11(20-13)10-19-14(17)18-7-3;2*1-2(3)4/h5-6,11,13H,7-10H2,1-4H3;2*1H3,(H,3,4)/b12-5-,15-6-;;.
What are the key properties of acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate?
acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate has a molecular weight of 404.46 g/mol, XLogP of 2.73, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;ethyl [5-[(Z)-1-[[(Z)-ethylideneamino]-methylamino]prop-1-enyl]oxolan-2-yl]methyl carbonate is sourced from PubChem (CID 177156119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).