C26H28F3N7O3 — CID 177156184
7-fluoro-5-[6-fluoro-2-[[(3S,4S)-3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]amino]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-5-yl]-N,3a-dimethylindole-3-carboxamide (PubChem CID 177156184) has the molecular formula C26H28F3N7O3 and a molecular weight of 543.55 g/mol. Its IUPAC name is 7-fluoro-5-[6-fluoro-2-[[(3S,4S)-3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]amino]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-5-yl]-N,3a-dimethylindole-3-carboxamide.
| Compound Name | 7-fluoro-5-[6-fluoro-2-[[(3S,4S)-3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]amino]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-5-yl]-N,3a-dimethylindole-3-carboxamide |
|---|---|
| PubChem CID | 177156184 |
| Molecular Formula | C26H28F3N7O3 |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 7-fluoro-5-[6-fluoro-2-[[(3S,4S)-3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]amino]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-5-yl]-N,3a-dimethylindole-3-carboxamide |
| SMILES | CNC(=O)C1=CN=C2C(F)=CC(c3c(F)cn4nc(N[C@H]5CCN(C6COC6)C[C@@H]5F)nc(OC)c34)=CC12C |
| InChI | InChI=1S/C26H28F3N7O3/c1-26-7-13(6-16(27)22(26)31-8-15(26)23(37)30-2)20-18(29)10-36-21(20)24(38-3)33-25(34-36)32-19-4-5-35(9-17(19)28)14-11-39-12-14/h6-8,10,14,17,19H,4-5,9,11-12H2,1-3H3,(H,30,37)(H,32,34)/t17-,19-,26?/m0/s1 |
| InChIKey | NTLJRHSMNWLQMH-YIKZKOFHSA-N |
| XLogP | 2.44 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |