C15H23BFN3O2 — CID 177156338
2-diazenyl-N-(3-fluoropropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 177156338) has the molecular formula C15H23BFN3O2 and a molecular weight of 307.18 g/mol. Its IUPAC name is 2-diazenyl-N-(3-fluoropropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 2-diazenyl-N-(3-fluoropropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 177156338 |
| Molecular Formula | C15H23BFN3O2 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-diazenyl-N-(3-fluoropropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | [H]/N=N/c1ccc(B2OC(C)(C)C(C)(C)O2)cc1NCCCF |
| InChI | InChI=1S/C15H23BFN3O2/c1-14(2)15(3,4)22-16(21-14)11-6-7-12(20-18)13(10-11)19-9-5-8-17/h6-7,10,18-19H,5,8-9H2,1-4H3/b20-18+ |
| InChIKey | BSURLQOPBKHMAH-CZIZESTLSA-N |
| XLogP | 3.42 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|