C17H17F3N6O — CID 177156339
2-diazenyl-N-(2,2-difluoropropyl)-5-(6-fluoro-4-methoxy-2-methylpyrrolo[2,1-f][1,2,4]triazin-5-yl)aniline (PubChem CID 177156339) has the molecular formula C17H17F3N6O and a molecular weight of 378.36 g/mol. Its IUPAC name is 2-diazenyl-N-(2,2-difluoropropyl)-5-(6-fluoro-4-methoxy-2-methylpyrrolo[2,1-f][1,2,4]triazin-5-yl)aniline.
| Compound Name | 2-diazenyl-N-(2,2-difluoropropyl)-5-(6-fluoro-4-methoxy-2-methylpyrrolo[2,1-f][1,2,4]triazin-5-yl)aniline |
|---|---|
| PubChem CID | 177156339 |
| Molecular Formula | C17H17F3N6O |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-diazenyl-N-(2,2-difluoropropyl)-5-(6-fluoro-4-methoxy-2-methylpyrrolo[2,1-f][1,2,4]triazin-5-yl)aniline |
| SMILES | [H]/N=N/c1ccc(-c2c(F)cn3nc(C)nc(OC)c23)cc1NCC(C)(F)F |
| InChI | InChI=1S/C17H17F3N6O/c1-9-23-16(27-3)15-14(11(18)7-26(15)25-9)10-4-5-12(24-21)13(6-10)22-8-17(2,19)20/h4-7,21-22H,8H2,1-3H3/b24-21+ |
| InChIKey | BUPKGJWOTWJTME-DARPEHSRSA-N |
| XLogP | 4.58 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|