C9H16FNO — CID 177156528
(3R,4S)-3-fluoro-4-methyl-1-(oxetan-3-yl)piperidine (PubChem CID 177156528) has the molecular formula C9H16FNO and a molecular weight of 173.23 g/mol. Its IUPAC name is (3R,4S)-3-fluoro-4-methyl-1-(oxetan-3-yl)piperidine.
| Compound Name | (3R,4S)-3-fluoro-4-methyl-1-(oxetan-3-yl)piperidine |
|---|---|
| PubChem CID | 177156528 |
| Molecular Formula | C9H16FNO |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (3R,4S)-3-fluoro-4-methyl-1-(oxetan-3-yl)piperidine |
| SMILES | C[C@H]1CCN(C2COC2)C[C@@H]1F |
| InChI | InChI=1S/C9H16FNO/c1-7-2-3-11(4-9(7)10)8-5-12-6-8/h7-9H,2-6H2,1H3/t7-,9-/m0/s1 |
| InChIKey | PTPYZHPHUNTWCH-CBAPKCEASA-N |
| XLogP | 1.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |