C20H23F2N5S2 — CID 177156770
3-[2-amino-5-[4-(ethylideneamino)-3-fluoro-5-methylphenyl]-6-fluoropyrrolo[2,1-f][1,2,4]triazin-4-yl]pentane-2,2-dithiol (PubChem CID 177156770) has the molecular formula C20H23F2N5S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 3-[2-amino-5-[4-(ethylideneamino)-3-fluoro-5-methylphenyl]-6-fluoropyrrolo[2,1-f][1,2,4]triazin-4-yl]pentane-2,2-dithiol.
| Compound Name | 3-[2-amino-5-[4-(ethylideneamino)-3-fluoro-5-methylphenyl]-6-fluoropyrrolo[2,1-f][1,2,4]triazin-4-yl]pentane-2,2-dithiol |
|---|---|
| PubChem CID | 177156770 |
| Molecular Formula | C20H23F2N5S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 3-[2-amino-5-[4-(ethylideneamino)-3-fluoro-5-methylphenyl]-6-fluoropyrrolo[2,1-f][1,2,4]triazin-4-yl]pentane-2,2-dithiol |
| SMILES | C/C=N/c1c(C)cc(-c2c(F)cn3nc(N)nc(C(CC)C(C)(S)S)c23)cc1F |
| InChI | InChI=1S/C20H23F2N5S2/c1-5-12(20(4,28)29)17-18-15(14(22)9-27(18)26-19(23)25-17)11-7-10(3)16(24-6-2)13(21)8-11/h6-9,12,28-29H,5H2,1-4H3,(H2,23,26)/b24-6+ |
| InChIKey | QDLUVAVLGZLTBL-GFXGDVFHSA-N |
| XLogP | 5.36 |
| TPSA | 68.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|