C25H29BF3N5O3 — CID 177157043
N-methyl-4-[1-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 177157043) has the molecular formula C25H29BF3N5O3 and a molecular weight of 515.35 g/mol. Its IUPAC name is N-methyl-4-[1-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-methyl-4-[1-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 177157043 |
| Molecular Formula | C25H29BF3N5O3 |
| Molecular Weight | 515.35 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | N-methyl-4-[1-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CN(CC(F)(F)F)C(=O)c1ccc(-c2nc(Nc3ccc(B4OC(C)(C)C(C)(C)O4)cc3)n(C)n2)cc1 |
| InChI | InChI=1S/C25H29BF3N5O3/c1-23(2)24(3,4)37-26(36-23)18-11-13-19(14-12-18)30-22-31-20(32-34(22)6)16-7-9-17(10-8-16)21(35)33(5)15-25(27,28)29/h7-14H,15H2,1-6H3,(H,30,31,32) |
| InChIKey | YJEIMRVNFRKGTQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|