C8H13F2N — CID 177157131
(3aS,6aR)-4,4-difluoro-2-methyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole (PubChem CID 177157131) has the molecular formula C8H13F2N and a molecular weight of 161.19 g/mol. Its IUPAC name is (3aS,6aR)-4,4-difluoro-2-methyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole.
| Compound Name | (3aS,6aR)-4,4-difluoro-2-methyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 177157131 |
| Molecular Formula | C8H13F2N |
| Molecular Weight | 161.19 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | (3aS,6aR)-4,4-difluoro-2-methyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole |
| SMILES | CN1C[C@@H]2CCC(F)(F)[C@@H]2C1 |
| InChI | InChI=1S/C8H13F2N/c1-11-4-6-2-3-8(9,10)7(6)5-11/h6-7H,2-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | KGZRUNQYQJUGNX-NKWVEPMBSA-N |
| XLogP | 1.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |