About ethane;fluoromethane;3-fluoro-1-methylpyrrolidine
ethane;fluoromethane;3-fluoro-1-methylpyrrolidine (PubChem CID 177157428) has the molecular formula C8H19F2N
and a molecular weight of 167.24 g/mol. Its IUPAC name is ethane;fluoromethane;3-fluoro-1-methylpyrrolidine.
Molecular Properties
| Compound Name | ethane;fluoromethane;3-fluoro-1-methylpyrrolidine |
| PubChem CID | 177157428 |
| Molecular Formula | C8H19F2N |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.15 |
| IUPAC Name | ethane;fluoromethane;3-fluoro-1-methylpyrrolidine |
| SMILES | CC.CF.CN1CCC(F)C1 |
| InChI | InChI=1S/C5H10FN.C2H6.CH3F/c1-7-3-2-5(6)4-7;2*1-2/h5H,2-4H2,1H3;1-2H3;1H3 |
| InChIKey | XXXUDTJXPJCSPG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;fluoromethane;3-fluoro-1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;fluoromethane;3-fluoro-1-methylpyrrolidine?
The IUPAC name of ethane;fluoromethane;3-fluoro-1-methylpyrrolidine (CID 177157428) is ethane;fluoromethane;3-fluoro-1-methylpyrrolidine.
What is the SMILES notation for ethane;fluoromethane;3-fluoro-1-methylpyrrolidine?
The canonical SMILES for ethane;fluoromethane;3-fluoro-1-methylpyrrolidine is CC.CF.CN1CCC(F)C1.
What is the InChIKey of ethane;fluoromethane;3-fluoro-1-methylpyrrolidine?
The InChIKey is XXXUDTJXPJCSPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10FN.C2H6.CH3F/c1-7-3-2-5(6)4-7;2*1-2/h5H,2-4H2,1H3;1-2H3;1H3.
What are the key properties of ethane;fluoromethane;3-fluoro-1-methylpyrrolidine?
ethane;fluoromethane;3-fluoro-1-methylpyrrolidine has a molecular weight of 167.24 g/mol, XLogP of 2.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;fluoromethane;3-fluoro-1-methylpyrrolidine is sourced from PubChem (CID 177157428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).