C26H33F2N7O3Si — CID 177157470
5-(6-fluoro-3-pyridinyl)-N-[4-[5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-2-(2-methoxyethoxy)phenyl]-2-methyl-1,2,4-triazol-3-amine (PubChem CID 177157470) has the molecular formula C26H33F2N7O3Si and a molecular weight of 557.68 g/mol. Its IUPAC name is 5-(6-fluoro-3-pyridinyl)-N-[4-[5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-2-(2-methoxyethoxy)phenyl]-2-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(6-fluoro-3-pyridinyl)-N-[4-[5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-2-(2-methoxyethoxy)phenyl]-2-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 177157470 |
| Molecular Formula | C26H33F2N7O3Si |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 5-(6-fluoro-3-pyridinyl)-N-[4-[5-fluoro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-2-(2-methoxyethoxy)phenyl]-2-methyl-1,2,4-triazol-3-amine |
| SMILES | COCCOc1cc(-c2cnn(COCC[Si](C)(C)C)c2F)ccc1Nc1nc(-c2ccc(F)nc2)nn1C |
| InChI | InChI=1S/C26H33F2N7O3Si/c1-34-26(32-25(33-34)19-7-9-23(27)29-15-19)31-21-8-6-18(14-22(21)38-11-10-36-2)20-16-30-35(24(20)28)17-37-12-13-39(3,4)5/h6-9,14-16H,10-13,17H2,1-5H3,(H,31,32,33) |
| InChIKey | BKRVQKNWOURGQO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|