C19H14ClF2N7 — CID 177157471
3-chloro-4-[2-fluoro-4-[[5-(6-fluoro-3-pyridinyl)-2-methyl-1,2,4-triazol-3-yl]amino]phenyl]pyridin-2-amine (PubChem CID 177157471) has the molecular formula C19H14ClF2N7 and a molecular weight of 413.82 g/mol. Its IUPAC name is 3-chloro-4-[2-fluoro-4-[[5-(6-fluoro-3-pyridinyl)-2-methyl-1,2,4-triazol-3-yl]amino]phenyl]pyridin-2-amine.
| Compound Name | 3-chloro-4-[2-fluoro-4-[[5-(6-fluoro-3-pyridinyl)-2-methyl-1,2,4-triazol-3-yl]amino]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 177157471 |
| Molecular Formula | C19H14ClF2N7 |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 3-chloro-4-[2-fluoro-4-[[5-(6-fluoro-3-pyridinyl)-2-methyl-1,2,4-triazol-3-yl]amino]phenyl]pyridin-2-amine |
| SMILES | Cn1nc(-c2ccc(F)nc2)nc1Nc1ccc(-c2ccnc(N)c2Cl)c(F)c1 |
| InChI | InChI=1S/C19H14ClF2N7/c1-29-19(27-18(28-29)10-2-5-15(22)25-9-10)26-11-3-4-12(14(21)8-11)13-6-7-24-17(23)16(13)20/h2-9H,1H3,(H2,23,24)(H,26,27,28) |
| InChIKey | KUFDWXRBAAKFFW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|