C23H29BFN5O4 — CID 177157517
5-(6-fluoro-3-pyridinyl)-N-[2-(2-methoxyethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-methyl-1,2,4-triazol-3-amine (PubChem CID 177157517) has the molecular formula C23H29BFN5O4 and a molecular weight of 469.33 g/mol. Its IUPAC name is 5-(6-fluoro-3-pyridinyl)-N-[2-(2-methoxyethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(6-fluoro-3-pyridinyl)-N-[2-(2-methoxyethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 177157517 |
| Molecular Formula | C23H29BFN5O4 |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 5-(6-fluoro-3-pyridinyl)-N-[2-(2-methoxyethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-methyl-1,2,4-triazol-3-amine |
| SMILES | COCCOc1cc(B2OC(C)(C)C(C)(C)O2)ccc1Nc1nc(-c2ccc(F)nc2)nn1C |
| InChI | InChI=1S/C23H29BFN5O4/c1-22(2)23(3,4)34-24(33-22)16-8-9-17(18(13-16)32-12-11-31-6)27-21-28-20(29-30(21)5)15-7-10-19(25)26-14-15/h7-10,13-14H,11-12H2,1-6H3,(H,27,28,29) |
| InChIKey | HAMQIKKUGVIBOE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|