C28H34F5N5O4 — CID 177158218
4-[7-[5-amino-3-fluoro-2-(trifluoromethyl)phenyl]-2-methoxy-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]-6-methyl-1,4-oxazepan-2-one;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 177158218) has the molecular formula C28H34F5N5O4 and a molecular weight of 599.60 g/mol. Its IUPAC name is 4-[7-[5-amino-3-fluoro-2-(trifluoromethyl)phenyl]-2-methoxy-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]-6-methyl-1,4-oxazepan-2-one;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 4-[7-[5-amino-3-fluoro-2-(trifluoromethyl)phenyl]-2-methoxy-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]-6-methyl-1,4-oxazepan-2-one;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 177158218 |
| Molecular Formula | C28H34F5N5O4 |
| Molecular Weight | 599.60 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 4-[7-[5-amino-3-fluoro-2-(trifluoromethyl)phenyl]-2-methoxy-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]-6-methyl-1,4-oxazepan-2-one;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | COc1nc2c(c(N3CC(=O)OCC(C)C3)n1)COC(c1cc(N)cc(F)c1C(F)(F)F)C2.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C21H22F4N4O4.C7H12FN/c1-10-6-29(7-17(30)33-8-10)19-13-9-32-16(5-15(13)27-20(28-19)31-2)12-3-11(26)4-14(22)18(12)21(23,24)25;8-6-4-7-2-1-3-9(7)5-6/h3-4,10,16H,5-9,26H2,1-2H3;6-7H,1-5H2 |
| InChIKey | QBJPFHKBPOKJPC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|