C17H27NO — CID 177158483
1,7-di(propan-2-yl)-3,4-dihydroquinolin-2-one;ethane (PubChem CID 177158483) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 1,7-di(propan-2-yl)-3,4-dihydroquinolin-2-one;ethane.
| Compound Name | 1,7-di(propan-2-yl)-3,4-dihydroquinolin-2-one;ethane |
|---|---|
| PubChem CID | 177158483 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 1,7-di(propan-2-yl)-3,4-dihydroquinolin-2-one;ethane |
| SMILES | CC.CC(C)c1ccc2c(c1)N(C(C)C)C(=O)CC2 |
| InChI | InChI=1S/C15H21NO.C2H6/c1-10(2)13-6-5-12-7-8-15(17)16(11(3)4)14(12)9-13;1-2/h5-6,9-11H,7-8H2,1-4H3;1-2H3 |
| InChIKey | GYVMDRWEJSNYBN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |