About CID 177158562
CID 177158562 (PubChem CID 177158562) has the molecular formula C9H16B3NO2
and a molecular weight of 202.67 g/mol.
Molecular Properties
| Compound Name | CID 177158562 |
| PubChem CID | 177158562 |
| Molecular Formula | C9H16B3NO2 |
| Molecular Weight | 202.67 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])OC(C)C1CN(CC)CCO1 |
| InChI | InChI=1S/C9H16B3NO2/c1-3-13-4-5-14-8(6-13)7(2)15-9(10,11)12/h7-8H,3-6H2,1-2H3 |
| InChIKey | YTOZIQIYMSMGDU-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.67 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177158562 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177158562?
The IUPAC name of CID 177158562 (CID 177158562) is not available.
What is the SMILES notation for CID 177158562?
The canonical SMILES for CID 177158562 is [B]C([B])([B])OC(C)C1CN(CC)CCO1.
What is the InChIKey of CID 177158562?
The InChIKey is YTOZIQIYMSMGDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16B3NO2/c1-3-13-4-5-14-8(6-13)7(2)15-9(10,11)12/h7-8H,3-6H2,1-2H3.
What are the key properties of CID 177158562?
CID 177158562 has a molecular weight of 202.67 g/mol, XLogP of -0.77, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177158562 is sourced from PubChem (CID 177158562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).