About 3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one
3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one (PubChem CID 177158573) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one.
Molecular Properties
| Compound Name | 3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one |
| PubChem CID | 177158573 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one |
| SMILES | CC(C)c1cnc2c(c1)NC(=O)C2(C)C |
| InChI | InChI=1S/C12H16N2O/c1-7(2)8-5-9-10(13-6-8)12(3,4)11(15)14-9/h5-7H,1-4H3,(H,14,15) |
| InChIKey | FBDYTFXOXOTIOA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one?
The IUPAC name of 3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one (CID 177158573) is 3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one.
What is the SMILES notation for 3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one?
The canonical SMILES for 3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one is CC(C)c1cnc2c(c1)NC(=O)C2(C)C.
What is the InChIKey of 3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one?
The InChIKey is FBDYTFXOXOTIOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-7(2)8-5-9-10(13-6-8)12(3,4)11(15)14-9/h5-7H,1-4H3,(H,14,15).
What are the key properties of 3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one?
3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one has a molecular weight of 204.27 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-6-propan-2-yl-1H-pyrrolo[3,2-b]pyridin-2-one is sourced from PubChem (CID 177158573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).