About 5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane
5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane (PubChem CID 177158816) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane.
Molecular Properties
| Compound Name | 5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane |
| PubChem CID | 177158816 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane |
| SMILES | C/C(=C\c1[nH]ncc1C)C(C)C.CC |
| InChI | InChI=1S/C10H16N2.C2H6/c1-7(2)8(3)5-10-9(4)6-11-12-10;1-2/h5-7H,1-4H3,(H,11,12);1-2H3/b8-5+; |
| InChIKey | KJEVNNLFDLGOOI-HAAWTFQLSA-N |
| XLogP | 3.80 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane?
The IUPAC name of 5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane (CID 177158816) is 5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane.
What is the SMILES notation for 5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane?
The canonical SMILES for 5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane is C/C(=C\c1[nH]ncc1C)C(C)C.CC.
What is the InChIKey of 5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane?
The InChIKey is KJEVNNLFDLGOOI-HAAWTFQLSA-N. The full InChI is InChI=1S/C10H16N2.C2H6/c1-7(2)8(3)5-10-9(4)6-11-12-10;1-2/h5-7H,1-4H3,(H,11,12);1-2H3/b8-5+;.
What are the key properties of 5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane?
5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane has a molecular weight of 194.32 g/mol, XLogP of 3.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2,3-dimethylbut-1-enyl]-4-methyl-1H-pyrazole;ethane is sourced from PubChem (CID 177158816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).