C22H24N6O3 — CID 177158902
butyl N-[2-[6-amino-1-(methylamino)-2,7-naphthyridin-4-yl]-1,3-benzoxazol-5-yl]-N-methylcarbamate (PubChem CID 177158902) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is butyl N-[2-[6-amino-1-(methylamino)-2,7-naphthyridin-4-yl]-1,3-benzoxazol-5-yl]-N-methylcarbamate.
| Compound Name | butyl N-[2-[6-amino-1-(methylamino)-2,7-naphthyridin-4-yl]-1,3-benzoxazol-5-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 177158902 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | butyl N-[2-[6-amino-1-(methylamino)-2,7-naphthyridin-4-yl]-1,3-benzoxazol-5-yl]-N-methylcarbamate |
| SMILES | CCCCOC(=O)N(C)c1ccc2oc(-c3cnc(NC)c4cnc(N)cc34)nc2c1 |
| InChI | InChI=1S/C22H24N6O3/c1-4-5-8-30-22(29)28(3)13-6-7-18-17(9-13)27-21(31-18)16-12-26-20(24-2)15-11-25-19(23)10-14(15)16/h6-7,9-12H,4-5,8H2,1-3H3,(H2,23,25)(H,24,26) |
| InChIKey | SSEZDYKLDWFWAL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|