About N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide
N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide (PubChem CID 177159185) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide.
Molecular Properties
| Compound Name | N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide |
| PubChem CID | 177159185 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide |
| SMILES | CCC1(C)C=CC(NC=O)=C(OC)C=C1 |
| InChI | InChI=1S/C12H17NO2/c1-4-12(2)7-5-10(13-9-14)11(15-3)6-8-12/h5-9H,4H2,1-3H3,(H,13,14) |
| InChIKey | UKGXVAAIVLGOOP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide?
The IUPAC name of N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide (CID 177159185) is N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide.
What is the SMILES notation for N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide?
The canonical SMILES for N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide is CCC1(C)C=CC(NC=O)=C(OC)C=C1.
What is the InChIKey of N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide?
The InChIKey is UKGXVAAIVLGOOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-4-12(2)7-5-10(13-9-14)11(15-3)6-8-12/h5-9H,4H2,1-3H3,(H,13,14).
What are the key properties of N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide?
N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide has a molecular weight of 207.27 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-ethyl-2-methoxy-5-methylcyclohepta-1,3,6-trien-1-yl)formamide is sourced from PubChem (CID 177159185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).