C20H20F6N6O2 — CID 177159627
(2S)-2-[3-[3,5-difluoro-6-[[(3R,4R)-4-fluoropiperidin-3-yl]amino]-2-pyridinyl]-7-methoxyimidazo[1,2-b]pyridazin-6-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 177159627) has the molecular formula C20H20F6N6O2 and a molecular weight of 490.41 g/mol. Its IUPAC name is (2S)-2-[3-[3,5-difluoro-6-[[(3R,4R)-4-fluoropiperidin-3-yl]amino]-2-pyridinyl]-7-methoxyimidazo[1,2-b]pyridazin-6-yl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-2-[3-[3,5-difluoro-6-[[(3R,4R)-4-fluoropiperidin-3-yl]amino]-2-pyridinyl]-7-methoxyimidazo[1,2-b]pyridazin-6-yl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 177159627 |
| Molecular Formula | C20H20F6N6O2 |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | (2S)-2-[3-[3,5-difluoro-6-[[(3R,4R)-4-fluoropiperidin-3-yl]amino]-2-pyridinyl]-7-methoxyimidazo[1,2-b]pyridazin-6-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | COc1cc2ncc(-c3nc(N[C@@H]4CNCC[C@H]4F)c(F)cc3F)n2nc1[C@](C)(O)C(F)(F)F |
| InChI | InChI=1S/C20H20F6N6O2/c1-19(33,20(24,25)26)17-14(34-2)6-15-28-8-13(32(15)31-17)16-10(22)5-11(23)18(30-16)29-12-7-27-4-3-9(12)21/h5-6,8-9,12,27,33H,3-4,7H2,1-2H3,(H,29,30)/t9-,12-,19+/m1/s1 |
| InChIKey | SKIPWHDERWTBIL-VVSLUIPWSA-N |
| XLogP | 2.96 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |