C30H38BN10O6 — CID 177160298
CID 177160298 (PubChem CID 177160298) has the molecular formula C30H38BN10O6 and a molecular weight of 645.51 g/mol.
| Compound Name | CID 177160298 |
|---|---|
| PubChem CID | 177160298 |
| Molecular Formula | C30H38BN10O6 |
| Molecular Weight | 645.51 g/mol |
| Exact Mass | 645.31 |
| IUPAC Name | — |
| SMILES | CC(C)(C)n1nc(-c2noc(C3CC3)c2-c2ncc(C3CCN(C(=O)OCC(=O)O)CC3)cn2)c2c(N)ncnc21.CCC(N)=O.[B] |
| InChI | InChI=1S/C27H31N9O5.C3H7NO.B/c1-27(2,3)36-25-19(23(28)31-13-32-25)20(33-36)21-18(22(41-34-21)15-4-5-15)24-29-10-16(11-30-24)14-6-8-35(9-7-14)26(39)40-12-17(37)38;1-2-3(4)5;/h10-11,13-15H,4-9,12H2,1-3H3,(H,37,38)(H2,28,31,32);2H2,1H3,(H2,4,5); |
| InChIKey | SBKQXXYXBBEFGP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 231.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|