C17H27F3N4O2 — CID 177160403
3-[[(2E,4Z)-5-[methyl-[2-(methylamino)ethyl]amino]-4-(trifluoromethyl)hepta-2,4-dien-2-yl]amino]piperidine-2,6-dione (PubChem CID 177160403) has the molecular formula C17H27F3N4O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-[[(2E,4Z)-5-[methyl-[2-(methylamino)ethyl]amino]-4-(trifluoromethyl)hepta-2,4-dien-2-yl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[(2E,4Z)-5-[methyl-[2-(methylamino)ethyl]amino]-4-(trifluoromethyl)hepta-2,4-dien-2-yl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177160403 |
| Molecular Formula | C17H27F3N4O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 3-[[(2E,4Z)-5-[methyl-[2-(methylamino)ethyl]amino]-4-(trifluoromethyl)hepta-2,4-dien-2-yl]amino]piperidine-2,6-dione |
| SMILES | CC/C(=C(\C=C(/C)NC1CCC(=O)NC1=O)C(F)(F)F)N(C)CCNC |
| InChI | InChI=1S/C17H27F3N4O2/c1-5-14(24(4)9-8-21-3)12(17(18,19)20)10-11(2)22-13-6-7-15(25)23-16(13)26/h10,13,21-22H,5-9H2,1-4H3,(H,23,25,26)/b11-10+,14-12- |
| InChIKey | KYJMAUCVUMNULR-SEBJLUHNSA-N |
| XLogP | 1.66 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|