About CID 177161125
CID 177161125 (PubChem CID 177161125) has the molecular formula C6H11INO-
and a molecular weight of 240.06 g/mol.
Molecular Properties
| Compound Name | CID 177161125 |
| PubChem CID | 177161125 |
| Molecular Formula | C6H11INO- |
| Molecular Weight | 240.06 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | — |
| SMILES | CCN1CCC[I-]C1=O |
| InChI | InChI=1S/C6H11INO/c1-2-8-5-3-4-7-6(8)9/h2-5H2,1H3/q-1 |
| InChIKey | JVHWWGBBSLIHEE-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.06 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 177161125 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177161125?
The IUPAC name of CID 177161125 (CID 177161125) is not available.
What is the SMILES notation for CID 177161125?
The canonical SMILES for CID 177161125 is CCN1CCC[I-]C1=O.
What is the InChIKey of CID 177161125?
The InChIKey is JVHWWGBBSLIHEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11INO/c1-2-8-5-3-4-7-6(8)9/h2-5H2,1H3/q-1.
What are the key properties of CID 177161125?
CID 177161125 has a molecular weight of 240.06 g/mol, XLogP of -2.08, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177161125 is sourced from PubChem (CID 177161125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).