C14H17BrN2 — CID 177161440
3-bromo-N,N,9-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-10-amine (PubChem CID 177161440) has the molecular formula C14H17BrN2 and a molecular weight of 293.21 g/mol. Its IUPAC name is 3-bromo-N,N,9-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-10-amine.
| Compound Name | 3-bromo-N,N,9-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-10-amine |
|---|---|
| PubChem CID | 177161440 |
| Molecular Formula | C14H17BrN2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 3-bromo-N,N,9-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-10-amine |
| SMILES | CC1c2cccc3c(Br)cn(c23)CC1N(C)C |
| InChI | InChI=1S/C14H17BrN2/c1-9-10-5-4-6-11-12(15)7-17(14(10)11)8-13(9)16(2)3/h4-7,9,13H,8H2,1-3H3 |
| InChIKey | FBICGMQJEUCCFX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |