C19H22F2N2 — CID 177161585
6-fluoro-3-[(3Z,5E)-5-fluorohepta-1,3,5-trien-4-yl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene;methanamine (PubChem CID 177161585) has the molecular formula C19H22F2N2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 6-fluoro-3-[(3Z,5E)-5-fluorohepta-1,3,5-trien-4-yl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene;methanamine.
| Compound Name | 6-fluoro-3-[(3Z,5E)-5-fluorohepta-1,3,5-trien-4-yl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene;methanamine |
|---|---|
| PubChem CID | 177161585 |
| Molecular Formula | C19H22F2N2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 6-fluoro-3-[(3Z,5E)-5-fluorohepta-1,3,5-trien-4-yl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene;methanamine |
| SMILES | C=C/C=C(C(\F)=C/C)/c1cn2c3c(cc(F)cc13)CCC2.CN |
| InChI | InChI=1S/C18H17F2N.CH5N/c1-3-6-14(17(20)4-2)16-11-21-8-5-7-12-9-13(19)10-15(16)18(12)21;1-2/h3-4,6,9-11H,1,5,7-8H2,2H3;2H2,1H3/b14-6-,17-4+; |
| InChIKey | RQVBYBXDYHPJGD-JOBSNQKUSA-N |
| XLogP | 4.74 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|