About ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide
ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide (PubChem CID 177161853) has the molecular formula C13H24N2OS
and a molecular weight of 256.41 g/mol. Its IUPAC name is ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide.
Molecular Properties
| Compound Name | ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide |
| PubChem CID | 177161853 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide |
| SMILES | CC.CC.Cc1ccc(N2CCCS2=O)nc1 |
| InChI | InChI=1S/C9H12N2OS.2C2H6/c1-8-3-4-9(10-7-8)11-5-2-6-13(11)12;2*1-2/h3-4,7H,2,5-6H2,1H3;2*1-2H3 |
| InChIKey | NCAVMKOPFKJNPG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide?
The IUPAC name of ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide (CID 177161853) is ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide.
What is the SMILES notation for ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide?
The canonical SMILES for ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide is CC.CC.Cc1ccc(N2CCCS2=O)nc1.
What is the InChIKey of ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide?
The InChIKey is NCAVMKOPFKJNPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OS.2C2H6/c1-8-3-4-9(10-7-8)11-5-2-6-13(11)12;2*1-2/h3-4,7H,2,5-6H2,1H3;2*1-2H3.
What are the key properties of ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide?
ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide has a molecular weight of 256.41 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(5-methyl-2-pyridinyl)-1,2-thiazolidine 1-oxide is sourced from PubChem (CID 177161853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).