C21H26N6O2 — CID 177163117
6-[(6-aminopyrimidin-4-yl)amino]-1',7',7',8-tetramethylspiro[2H-imidazo[1,5-a]pyridine-3,2'-bicyclo[2.2.1]heptane]-1,5-dione (PubChem CID 177163117) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 6-[(6-aminopyrimidin-4-yl)amino]-1',7',7',8-tetramethylspiro[2H-imidazo[1,5-a]pyridine-3,2'-bicyclo[2.2.1]heptane]-1,5-dione.
| Compound Name | 6-[(6-aminopyrimidin-4-yl)amino]-1',7',7',8-tetramethylspiro[2H-imidazo[1,5-a]pyridine-3,2'-bicyclo[2.2.1]heptane]-1,5-dione |
|---|---|
| PubChem CID | 177163117 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 6-[(6-aminopyrimidin-4-yl)amino]-1',7',7',8-tetramethylspiro[2H-imidazo[1,5-a]pyridine-3,2'-bicyclo[2.2.1]heptane]-1,5-dione |
| SMILES | Cc1cc(Nc2cc(N)ncn2)c(=O)n2c1C(=O)NC21CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C21H26N6O2/c1-11-7-13(25-15-8-14(22)23-10-24-15)18(29)27-16(11)17(28)26-21(27)9-12-5-6-20(21,4)19(12,2)3/h7-8,10,12H,5-6,9H2,1-4H3,(H,26,28)(H3,22,23,24,25) |
| InChIKey | NLBCQKCTTOQZCH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |