C29H54 — CID 177164118
(4Z,6Z)-5,7-ditert-butyl-3,4,9,9-tetramethyl-6-(2-methylbutan-2-yl)-8-methylideneundeca-4,6-diene (PubChem CID 177164118) has the molecular formula C29H54 and a molecular weight of 402.75 g/mol. Its IUPAC name is (4Z,6Z)-5,7-ditert-butyl-3,4,9,9-tetramethyl-6-(2-methylbutan-2-yl)-8-methylideneundeca-4,6-diene.
| Compound Name | (4Z,6Z)-5,7-ditert-butyl-3,4,9,9-tetramethyl-6-(2-methylbutan-2-yl)-8-methylideneundeca-4,6-diene |
|---|---|
| PubChem CID | 177164118 |
| Molecular Formula | C29H54 |
| Molecular Weight | 402.75 g/mol |
| Exact Mass | 402.42 |
| IUPAC Name | (4Z,6Z)-5,7-ditert-butyl-3,4,9,9-tetramethyl-6-(2-methylbutan-2-yl)-8-methylideneundeca-4,6-diene |
| SMILES | C=C(/C(=C(C(=C(\C)C(C)CC)\C(C)(C)C)/C(C)(C)CC)C(C)(C)C)C(C)(C)CC |
| InChI | InChI=1S/C29H54/c1-17-20(4)21(5)23(26(7,8)9)25(29(15,16)19-3)24(27(10,11)12)22(6)28(13,14)18-2/h20H,6,17-19H2,1-5,7-16H3/b23-21+,25-24- |
| InChIKey | SXNYZEWYDMCGIB-UNGFZDNBSA-N |
| XLogP | 10.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.75 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|