C26H22ClF2NO7S — CID 177166307
methyl N-[(E)-5-[5-[(E)-3-[3-chloro-5-(3,4-difluorophenoxy)thiophen-2-yl]-2-methylprop-2-enoyl]-4-hydroxy-6-oxopyran-2-yl]pent-1-enyl]carbamate (PubChem CID 177166307) has the molecular formula C26H22ClF2NO7S and a molecular weight of 565.98 g/mol. Its IUPAC name is methyl N-[(E)-5-[5-[(E)-3-[3-chloro-5-(3,4-difluorophenoxy)thiophen-2-yl]-2-methylprop-2-enoyl]-4-hydroxy-6-oxopyran-2-yl]pent-1-enyl]carbamate.
| Compound Name | methyl N-[(E)-5-[5-[(E)-3-[3-chloro-5-(3,4-difluorophenoxy)thiophen-2-yl]-2-methylprop-2-enoyl]-4-hydroxy-6-oxopyran-2-yl]pent-1-enyl]carbamate |
|---|---|
| PubChem CID | 177166307 |
| Molecular Formula | C26H22ClF2NO7S |
| Molecular Weight | 565.98 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | methyl N-[(E)-5-[5-[(E)-3-[3-chloro-5-(3,4-difluorophenoxy)thiophen-2-yl]-2-methylprop-2-enoyl]-4-hydroxy-6-oxopyran-2-yl]pent-1-enyl]carbamate |
| SMILES | COC(=O)N/C=C/CCCc1cc(O)c(C(=O)/C(C)=C/c2sc(Oc3ccc(F)c(F)c3)cc2Cl)c(=O)o1 |
| InChI | InChI=1S/C26H22ClF2NO7S/c1-14(10-21-17(27)13-22(38-21)36-16-7-8-18(28)19(29)11-16)24(32)23-20(31)12-15(37-25(23)33)6-4-3-5-9-30-26(34)35-2/h5,7-13,31H,3-4,6H2,1-2H3,(H,30,34)/b9-5+,14-10+ |
| InChIKey | STFPNSLEBQWJRD-LQQFGEHRSA-N |
| XLogP | 6.61 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.98 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|