C21H36N2 — CID 177167069
ethane;(4E,5Z)-4-ethylidene-3-(1,3,4,5-tetrahydroisoindol-2-yl)hepta-1,5-dien-2-amine (PubChem CID 177167069) has the molecular formula C21H36N2 and a molecular weight of 316.53 g/mol. Its IUPAC name is ethane;(4E,5Z)-4-ethylidene-3-(1,3,4,5-tetrahydroisoindol-2-yl)hepta-1,5-dien-2-amine.
| Compound Name | ethane;(4E,5Z)-4-ethylidene-3-(1,3,4,5-tetrahydroisoindol-2-yl)hepta-1,5-dien-2-amine |
|---|---|
| PubChem CID | 177167069 |
| Molecular Formula | C21H36N2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | ethane;(4E,5Z)-4-ethylidene-3-(1,3,4,5-tetrahydroisoindol-2-yl)hepta-1,5-dien-2-amine |
| SMILES | C=C(N)C(C(/C=C\C)=C/C)N1CC2=C(CCC=C2)C1.CC.CC |
| InChI | InChI=1S/C17H24N2.2C2H6/c1-4-8-14(5-2)17(13(3)18)19-11-15-9-6-7-10-16(15)12-19;2*1-2/h4-6,8-9,17H,3,7,10-12,18H2,1-2H3;2*1-2H3/b8-4-,14-5+;; |
| InChIKey | HEGCHXLTZJTNDR-FPFOSOLISA-N |
| XLogP | 5.36 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|