C15H21F3N2 — CID 177168022
N'-[(4E)-5-ethenyl-2,6-dimethylocta-2,4-dien-3-yl]-2,2,2-trifluoro-N-methylideneethanimidamide (PubChem CID 177168022) has the molecular formula C15H21F3N2 and a molecular weight of 286.34 g/mol. Its IUPAC name is N'-[(4E)-5-ethenyl-2,6-dimethylocta-2,4-dien-3-yl]-2,2,2-trifluoro-N-methylideneethanimidamide.
| Compound Name | N'-[(4E)-5-ethenyl-2,6-dimethylocta-2,4-dien-3-yl]-2,2,2-trifluoro-N-methylideneethanimidamide |
|---|---|
| PubChem CID | 177168022 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N'-[(4E)-5-ethenyl-2,6-dimethylocta-2,4-dien-3-yl]-2,2,2-trifluoro-N-methylideneethanimidamide |
| SMILES | C=C/C(=C\C(/N=C(/N=C)C(F)(F)F)=C(C)C)C(C)CC |
| InChI | InChI=1S/C15H21F3N2/c1-7-11(5)12(8-2)9-13(10(3)4)20-14(19-6)15(16,17)18/h8-9,11H,2,6-7H2,1,3-5H3/b12-9+,20-14- |
| InChIKey | MLKVRNFPJKDPQM-BOIKWEOWSA-N |
| XLogP | 5.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|