C19H35N5O2 — CID 177168075
tert-butyl N-[(2-pentan-3-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]carbamate;ethane;methane (PubChem CID 177168075) has the molecular formula C19H35N5O2 and a molecular weight of 365.52 g/mol. Its IUPAC name is tert-butyl N-[(2-pentan-3-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]carbamate;ethane;methane.
| Compound Name | tert-butyl N-[(2-pentan-3-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]carbamate;ethane;methane |
|---|---|
| PubChem CID | 177168075 |
| Molecular Formula | C19H35N5O2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | tert-butyl N-[(2-pentan-3-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]carbamate;ethane;methane |
| SMILES | C.CC.CCC(CC)c1nc(NNC(=O)OC(C)(C)C)c2cccn2n1 |
| InChI | InChI=1S/C16H25N5O2.C2H6.CH4/c1-6-11(7-2)13-17-14(12-9-8-10-21(12)20-13)18-19-15(22)23-16(3,4)5;1-2;/h8-11H,6-7H2,1-5H3,(H,19,22)(H,17,18,20);1-2H3;1H4 |
| InChIKey | NPHIIYJNGNQZLL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|