C17H26N6O2 — CID 177168109
tert-butyl N-amino-N-[2-[cyclopentyl(methyl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate (PubChem CID 177168109) has the molecular formula C17H26N6O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is tert-butyl N-amino-N-[2-[cyclopentyl(methyl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate.
| Compound Name | tert-butyl N-amino-N-[2-[cyclopentyl(methyl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate |
|---|---|
| PubChem CID | 177168109 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | tert-butyl N-amino-N-[2-[cyclopentyl(methyl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]carbamate |
| SMILES | CN(c1nc(N(N)C(=O)OC(C)(C)C)c2cccn2n1)C1CCCC1 |
| InChI | InChI=1S/C17H26N6O2/c1-17(2,3)25-16(24)23(18)14-13-10-7-11-22(13)20-15(19-14)21(4)12-8-5-6-9-12/h7,10-12H,5-6,8-9,18H2,1-4H3 |
| InChIKey | NKEUBRSCIWGBNG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|