C19H27O2P — CID 177168464
bis(ethenyl)-[(5-methoxycyclohepta-1,4,6-trien-1-yl)methoxy]phosphane;(2Z,4Z)-hexa-2,4-diene (PubChem CID 177168464) has the molecular formula C19H27O2P and a molecular weight of 318.40 g/mol. Its IUPAC name is bis(ethenyl)-[(5-methoxycyclohepta-1,4,6-trien-1-yl)methoxy]phosphane;(2Z,4Z)-hexa-2,4-diene.
| Compound Name | bis(ethenyl)-[(5-methoxycyclohepta-1,4,6-trien-1-yl)methoxy]phosphane;(2Z,4Z)-hexa-2,4-diene |
|---|---|
| PubChem CID | 177168464 |
| Molecular Formula | C19H27O2P |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | bis(ethenyl)-[(5-methoxycyclohepta-1,4,6-trien-1-yl)methoxy]phosphane;(2Z,4Z)-hexa-2,4-diene |
| SMILES | C/C=C\C=C/C.C=CP(C=C)OCC1=CCC=C(OC)C=C1 |
| InChI | InChI=1S/C13H17O2P.C6H10/c1-4-16(5-2)15-11-12-7-6-8-13(14-3)10-9-12;1-3-5-6-4-2/h4-5,7-10H,1-2,6,11H2,3H3;3-6H,1-2H3/b;5-3-,6-4- |
| InChIKey | VQLJGUIREIKCCB-NFAXKJQBSA-N |
| XLogP | 6.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|