C8H12F3N3O3S — CID 177168573
1-[4,4-difluoro-2-(fluorosulfonimidoyl)carbonylpyrrolidin-1-yl]-2-(methylamino)ethanone (PubChem CID 177168573) has the molecular formula C8H12F3N3O3S and a molecular weight of 287.26 g/mol. Its IUPAC name is 1-[4,4-difluoro-2-(fluorosulfonimidoyl)carbonylpyrrolidin-1-yl]-2-(methylamino)ethanone.
| Compound Name | 1-[4,4-difluoro-2-(fluorosulfonimidoyl)carbonylpyrrolidin-1-yl]-2-(methylamino)ethanone |
|---|---|
| PubChem CID | 177168573 |
| Molecular Formula | C8H12F3N3O3S |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1-[4,4-difluoro-2-(fluorosulfonimidoyl)carbonylpyrrolidin-1-yl]-2-(methylamino)ethanone |
| SMILES | [H]N=S(=O)(F)C(=O)C1CC(F)(F)CN1C(=O)CNC |
| InChI | InChI=1S/C8H12F3N3O3S/c1-13-3-6(15)14-4-8(9,10)2-5(14)7(16)18(11,12)17/h5,12-13H,2-4H2,1H3 |
| InChIKey | MCCAOAKZKUZPJT-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|