C14H17NO2 — CID 177170487
N,5-dimethyl-N-propyl-1-benzofuran-2-carboxamide (PubChem CID 177170487) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is N,5-dimethyl-N-propyl-1-benzofuran-2-carboxamide.
| Compound Name | N,5-dimethyl-N-propyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 177170487 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N,5-dimethyl-N-propyl-1-benzofuran-2-carboxamide |
| SMILES | CCCN(C)C(=O)c1cc2cc(C)ccc2o1 |
| InChI | InChI=1S/C14H17NO2/c1-4-7-15(3)14(16)13-9-11-8-10(2)5-6-12(11)17-13/h5-6,8-9H,4,7H2,1-3H3 |
| InChIKey | RQEKRAMZJPXJMF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |