C12H24N2O — CID 177173629
2-methyl-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one;2-methylpropane (PubChem CID 177173629) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-methyl-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one;2-methylpropane.
| Compound Name | 2-methyl-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one;2-methylpropane |
|---|---|
| PubChem CID | 177173629 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2-methyl-3,3a,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-4-one;2-methylpropane |
| SMILES | CC(C)C.CN1CC2CCNC(=O)C2C1 |
| InChI | InChI=1S/C8H14N2O.C4H10/c1-10-4-6-2-3-9-8(11)7(6)5-10;1-4(2)3/h6-7H,2-5H2,1H3,(H,9,11);4H,1-3H3 |
| InChIKey | AUCAMQJWQYKIFS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |