C25H26N2O5 — CID 177174458
(2,5-dioxopyrrolidin-1-yl) formate;1-[(4Z)-5-ethenyl-4-[(Z)-prop-1-enyl]-2-azabicyclo[6.4.0]dodeca-1(12),4,8,10-tetraen-6-yn-2-yl]butan-1-one (PubChem CID 177174458) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) formate;1-[(4Z)-5-ethenyl-4-[(Z)-prop-1-enyl]-2-azabicyclo[6.4.0]dodeca-1(12),4,8,10-tetraen-6-yn-2-yl]butan-1-one.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) formate;1-[(4Z)-5-ethenyl-4-[(Z)-prop-1-enyl]-2-azabicyclo[6.4.0]dodeca-1(12),4,8,10-tetraen-6-yn-2-yl]butan-1-one |
|---|---|
| PubChem CID | 177174458 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) formate;1-[(4Z)-5-ethenyl-4-[(Z)-prop-1-enyl]-2-azabicyclo[6.4.0]dodeca-1(12),4,8,10-tetraen-6-yn-2-yl]butan-1-one |
| SMILES | C=C/C1=C(\C=C/C)CN(C(=O)CCC)c2ccccc2C#C1.O=CON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H21NO.C5H5NO4/c1-4-9-18-15-21(20(22)10-5-2)19-12-8-7-11-17(19)14-13-16(18)6-3;7-3-10-6-4(8)1-2-5(6)9/h4,6-9,11-12H,3,5,10,15H2,1-2H3;3H,1-2H2/b9-4-,18-16-; |
| InChIKey | FHAQDKMLPKDSHE-PACCBDSNSA-N |
| XLogP | 3.47 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|