C22H21ClN6 — CID 177177240
6-chloro-2-[[4-(3-pyridin-3-yl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]quinazoline (PubChem CID 177177240) has the molecular formula C22H21ClN6 and a molecular weight of 404.91 g/mol. Its IUPAC name is 6-chloro-2-[[4-(3-pyridin-3-yl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]quinazoline.
| Compound Name | 6-chloro-2-[[4-(3-pyridin-3-yl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]quinazoline |
|---|---|
| PubChem CID | 177177240 |
| Molecular Formula | C22H21ClN6 |
| Molecular Weight | 404.91 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 6-chloro-2-[[4-(3-pyridin-3-yl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]quinazoline |
| SMILES | Clc1ccc2nc(CN3CCC(c4cc(-c5cccnc5)n[nH]4)CC3)ncc2c1 |
| InChI | InChI=1S/C22H21ClN6/c23-18-3-4-19-17(10-18)13-25-22(26-19)14-29-8-5-15(6-9-29)20-11-21(28-27-20)16-2-1-7-24-12-16/h1-4,7,10-13,15H,5-6,8-9,14H2,(H,27,28) |
| InChIKey | QRLPZXAUIYQPCT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.91 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |