C10H11BrN4O — CID 177177894
5-bromo-7-[(E)-2-ethoxyethenyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 177177894) has the molecular formula C10H11BrN4O and a molecular weight of 283.13 g/mol. Its IUPAC name is 5-bromo-7-[(E)-2-ethoxyethenyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-bromo-7-[(E)-2-ethoxyethenyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 177177894 |
| Molecular Formula | C10H11BrN4O |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 5-bromo-7-[(E)-2-ethoxyethenyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCO/C=C/c1cc(Br)c2c(N)ncnn12 |
| InChI | InChI=1S/C10H11BrN4O/c1-2-16-4-3-7-5-8(11)9-10(12)13-6-14-15(7)9/h3-6H,2H2,1H3,(H2,12,13,14)/b4-3+ |
| InChIKey | UZGVGXXEHHPSAT-ONEGZZNKSA-N |
| XLogP | 2.08 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|