C23H33N5O3 — CID 177178337
(2R,5R)-9-[[6-(ethylaminomethyl)pyridazin-3-yl]methoxy]-5-(hydroxymethyl)-1-methyl-2-propan-2-yl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one (PubChem CID 177178337) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is (2R,5R)-9-[[6-(ethylaminomethyl)pyridazin-3-yl]methoxy]-5-(hydroxymethyl)-1-methyl-2-propan-2-yl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one.
| Compound Name | (2R,5R)-9-[[6-(ethylaminomethyl)pyridazin-3-yl]methoxy]-5-(hydroxymethyl)-1-methyl-2-propan-2-yl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one |
|---|---|
| PubChem CID | 177178337 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (2R,5R)-9-[[6-(ethylaminomethyl)pyridazin-3-yl]methoxy]-5-(hydroxymethyl)-1-methyl-2-propan-2-yl-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one |
| SMILES | CCNCc1ccc(COc2ccc3c(c2)N(C)[C@H](C(C)C)C(=O)N[C@@H](CO)C3)nn1 |
| InChI | InChI=1S/C23H33N5O3/c1-5-24-12-17-7-8-18(27-26-17)14-31-20-9-6-16-10-19(13-29)25-23(30)22(15(2)3)28(4)21(16)11-20/h6-9,11,15,19,22,24,29H,5,10,12-14H2,1-4H3,(H,25,30)/t19-,22-/m1/s1 |
| InChIKey | FUNBHJZONHQXGG-DENIHFKCSA-N |
| XLogP | 1.66 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |