C17H25N5O3 — CID 177178392
5-(hydroxymethyl)-1-methyl-9-[(2Z,4Z)-1,2,5-triaminopenta-2,4-dienoxy]-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one (PubChem CID 177178392) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 5-(hydroxymethyl)-1-methyl-9-[(2Z,4Z)-1,2,5-triaminopenta-2,4-dienoxy]-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one.
| Compound Name | 5-(hydroxymethyl)-1-methyl-9-[(2Z,4Z)-1,2,5-triaminopenta-2,4-dienoxy]-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one |
|---|---|
| PubChem CID | 177178392 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 5-(hydroxymethyl)-1-methyl-9-[(2Z,4Z)-1,2,5-triaminopenta-2,4-dienoxy]-2,4,5,6-tetrahydro-1,4-benzodiazocin-3-one |
| SMILES | CN1CC(=O)NC(CO)Cc2ccc(OC(N)/C(N)=C/C=C\N)cc21 |
| InChI | InChI=1S/C17H25N5O3/c1-22-9-16(24)21-12(10-23)7-11-4-5-13(8-15(11)22)25-17(20)14(19)3-2-6-18/h2-6,8,12,17,23H,7,9-10,18-20H2,1H3,(H,21,24)/b6-2-,14-3- |
| InChIKey | HHYLSLBWVLPRCZ-MRROBAEXSA-N |
| XLogP | -0.87 |
| TPSA | 139.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|