About ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione
ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione (PubChem CID 177180233) has the molecular formula C15H19NO3
and a molecular weight of 261.32 g/mol. Its IUPAC name is ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione.
Molecular Properties
| Compound Name | ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione |
| PubChem CID | 177180233 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione |
| SMILES | CC.Cc1cccc2c1OCC21CCC(=O)NC1=O |
| InChI | InChI=1S/C13H13NO3.C2H6/c1-8-3-2-4-9-11(8)17-7-13(9)6-5-10(15)14-12(13)16;1-2/h2-4H,5-7H2,1H3,(H,14,15,16);1-2H3 |
| InChIKey | OQIAYIRZBJEEKV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione?
The IUPAC name of ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione (CID 177180233) is ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione.
What is the SMILES notation for ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione?
The canonical SMILES for ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione is CC.Cc1cccc2c1OCC21CCC(=O)NC1=O.
What is the InChIKey of ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione?
The InChIKey is OQIAYIRZBJEEKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3.C2H6/c1-8-3-2-4-9-11(8)17-7-13(9)6-5-10(15)14-12(13)16;1-2/h2-4H,5-7H2,1H3,(H,14,15,16);1-2H3.
What are the key properties of ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione?
ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione has a molecular weight of 261.32 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methylspiro[2H-1-benzofuran-3,3'-piperidine]-2',6'-dione is sourced from PubChem (CID 177180233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).