C30H33F3N8O3 — CID 177180595
4-[[[(2E)-3-[2-(2-aminoethoxy)ethoxy]-2-hydrazinylidenepropylidene]amino]methyl]-N-[2-methyl-5-(6-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]-2-(trifluoromethyl)benzamide (PubChem CID 177180595) has the molecular formula C30H33F3N8O3 and a molecular weight of 610.64 g/mol. Its IUPAC name is 4-[[[(2E)-3-[2-(2-aminoethoxy)ethoxy]-2-hydrazinylidenepropylidene]amino]methyl]-N-[2-methyl-5-(6-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[[[(2E)-3-[2-(2-aminoethoxy)ethoxy]-2-hydrazinylidenepropylidene]amino]methyl]-N-[2-methyl-5-(6-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 177180595 |
| Molecular Formula | C30H33F3N8O3 |
| Molecular Weight | 610.64 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | 4-[[[(2E)-3-[2-(2-aminoethoxy)ethoxy]-2-hydrazinylidenepropylidene]amino]methyl]-N-[2-methyl-5-(6-methylimidazo[1,2-a]pyrimidin-2-yl)phenyl]-2-(trifluoromethyl)benzamide |
| SMILES | Cc1cnc2nc(-c3ccc(C)c(NC(=O)c4ccc(C/N=C/C(COCCOCCN)=N\N)cc4C(F)(F)F)c3)cn2c1 |
| InChI | InChI=1S/C30H33F3N8O3/c1-19-13-37-29-39-27(17-41(29)16-19)22-5-3-20(2)26(12-22)38-28(42)24-6-4-21(11-25(24)30(31,32)33)14-36-15-23(40-35)18-44-10-9-43-8-7-34/h3-6,11-13,15-17H,7-10,14,18,34-35H2,1-2H3,(H,38,42)/b36-15+,40-23+ |
| InChIKey | RKMQLCCVBQOGRI-ZPPYMWDUSA-N |
| XLogP | 4.16 |
| TPSA | 154.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|