C22H37N3O4 — CID 177180848
2-formamido-N-[[(3S,5E)-1-methoxy-3-methyl-1-(1-methylpyrrolidin-2-yl)-5-[(Z)-prop-1-enyl]octa-5,7-dien-4-yl]oxymethyl]acetamide (PubChem CID 177180848) has the molecular formula C22H37N3O4 and a molecular weight of 407.56 g/mol. Its IUPAC name is 2-formamido-N-[[(3S,5E)-1-methoxy-3-methyl-1-(1-methylpyrrolidin-2-yl)-5-[(Z)-prop-1-enyl]octa-5,7-dien-4-yl]oxymethyl]acetamide.
| Compound Name | 2-formamido-N-[[(3S,5E)-1-methoxy-3-methyl-1-(1-methylpyrrolidin-2-yl)-5-[(Z)-prop-1-enyl]octa-5,7-dien-4-yl]oxymethyl]acetamide |
|---|---|
| PubChem CID | 177180848 |
| Molecular Formula | C22H37N3O4 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 2-formamido-N-[[(3S,5E)-1-methoxy-3-methyl-1-(1-methylpyrrolidin-2-yl)-5-[(Z)-prop-1-enyl]octa-5,7-dien-4-yl]oxymethyl]acetamide |
| SMILES | C=C/C=C(\C=C/C)C(OCNC(=O)CNC=O)[C@@H](C)CC(OC)C1CCCN1C |
| InChI | InChI=1S/C22H37N3O4/c1-6-9-18(10-7-2)22(29-16-24-21(27)14-23-15-26)17(3)13-20(28-5)19-11-8-12-25(19)4/h6-7,9-10,15,17,19-20,22H,1,8,11-14,16H2,2-5H3,(H,23,26)(H,24,27)/b10-7-,18-9+/t17-,19?,20?,22?/m0/s1 |
| InChIKey | PJFYZIUCPQWWGO-VGLPSQNASA-N |
| XLogP | 2.02 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|